Products 88038-94-2
CAS 88038-94-2 appears in our catalog under these names: 4'–Propyl–(1,1'–biphenyl)–4–carboxylic acid, 4-(4-Propylphenyl)benzoic acid, 4-(4-Propylphenyl)benzoic Acid, >98.0%(GC)(T), 4'-Propyl-[1,1'-Biphenyl]-4-carboxylic acid 98%, 4'-Propyl-[1,1'-biphenyl]-4-carboxylic acid, 98%, 98%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100g, 10g, 250g, 25g, 50g, 1g, 5g, 75g.
4-(4-propylphenyl)benzoic acid (CAS 88038-94-2) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 4-(4-propylphenyl)benzoic acid. InChIKey: HCPBURTZSXRGBN-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 4-(4-propylphenyl)benzoic acid |
| InChIKey | HCPBURTZSXRGBN-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(4-Propylphenyl)benzoic Acid, 4-(4-propylphenyl]benzoic acid, 4-(4-n-Propylphenyl)benzoic acid, 4'-Propyl-[1,1'-Biphenyl]-4-carboxylic acid, 4'-Propylbiphenyl-4-carboxylic Acid, 4-Propylbiphenyl-4'-carboxylic acid, 4-n-Propylbiphenyl-4'-carboxylic acid, 4-(p-n-Propylphenyl)benzoic acid, 4-Propyl-[1,1-Biphenyl]-4-carboxylic acid, 4'-Propyl[1,1'-biphenyl]-4-carboxylic acid