Products 88041-40-1
CAS 88041-40-1 is the registry number for Lemidosul. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(aminomethyl)-4-tert-butyl-6-methylsulfonylphenol (CAS 88041-40-1) is a chemical compound with the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. IUPAC name: 2-(aminomethyl)-4-tert-butyl-6-methylsulfonylphenol. InChIKey: SENZQDBEHBQBNR-UHFFFAOYSA-N.
| Molecular formula | C12H19NO3S |
|---|---|
| Molecular weight | 257.35 g/mol |
| IUPAC name | 2-(aminomethyl)-4-tert-butyl-6-methylsulfonylphenol |
| InChIKey | SENZQDBEHBQBNR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)S(=O)(=O)C)O)CN |
Computed by PubChem (NCBI)