CAS 881674-85-7 is the registry number for Ethyl 2-methyl-1-(phenylsulfonyl)-1H-pyrrole-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 1-(benzenesulfonyl)-2-methylpyrrole-3-carboxylate (CAS 881674-85-7) is a chemical compound with the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. IUPAC name: ethyl 1-(benzenesulfonyl)-2-methylpyrrole-3-carboxylate. InChIKey: FURKCOQHULSAFQ-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4S |
|---|---|
| Molecular weight | 293.34 g/mol |
| IUPAC name | ethyl 1-(benzenesulfonyl)-2-methylpyrrole-3-carboxylate |
| InChIKey | FURKCOQHULSAFQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C=C1)S(=O)(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)