CAS 881919-99-9 is the registry number for 4-Methoxy-3-(2S)-2-morpholinyl-benzonitrile Hydrochloride. Offered by: TRC. Available pack sizes: 50mg.
4-methoxy-3-[(2S)-morpholin-2-yl]benzonitrile;hydrochloride (CAS 881919-99-9) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 4-methoxy-3-[(2S)-morpholin-2-yl]benzonitrile;hydrochloride. InChIKey: AVDGLHIEAVBWON-UTONKHPSSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 4-methoxy-3-[(2S)-morpholin-2-yl]benzonitrile;hydrochloride |
| InChIKey | AVDGLHIEAVBWON-UTONKHPSSA-N |
| SMILES | COC1=C(C=C(C=C1)C#N)[C@H]2CNCCO2.Cl |
Computed by PubChem (NCBI)