CAS 883536-41-2 is the registry number for 2,3-Dimethyl-4-ethoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-ethoxy-2,3-dimethylbenzaldehyde (CAS 883536-41-2) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 4-ethoxy-2,3-dimethylbenzaldehyde. InChIKey: MZMCAAMUAGMBPT-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 4-ethoxy-2,3-dimethylbenzaldehyde |
| InChIKey | MZMCAAMUAGMBPT-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C=O)C)C |
Computed by PubChem (NCBI)