CAS 88375-62-6 appears in our catalog under these names: Droxidopa Impurity 13, (2S,3R)-2-Amino-3-(benzo(d)(1,3)dioxol-5-yl)-3-hydroxypropanoic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 2,5mg, 25mg.
(2S,3R)-2-amino-3-(1,3-benzodioxol-5-yl)-3-hydroxypropanoic acid (CAS 88375-62-6) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: (2S,3R)-2-amino-3-(1,3-benzodioxol-5-yl)-3-hydroxypropanoic acid. InChIKey: QNECLCOECOXTEW-DTWKUNHWSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-(1,3-benzodioxol-5-yl)-3-hydroxypropanoic acid |
| InChIKey | QNECLCOECOXTEW-DTWKUNHWSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)[C@H]([C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)