CAS 883803-89-2 appears in our catalog under these names: 5-Bromo-4-hydroxy-2,6-dimethylnicotinic Acid, 5-Bromo-4-hydroxy-2,6-dimethylnicotinic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid (CAS 883803-89-2) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 5-bromo-2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid. InChIKey: GXWVLFZDHVVCGO-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 5-bromo-2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | GXWVLFZDHVVCGO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C(=C(N1)C)Br)C(=O)O |
Computed by PubChem (NCBI)