CAS 883864-92-4 appears in our catalog under these names: 1,5-Naphthyridine-2-carbaldehyde, 97%, 1,5-Naphthyridine-2-carboxaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
1,5-naphthyridine-2-carbaldehyde (CAS 883864-92-4) is a chemical compound with the molecular formula C9H6N2O and a molecular weight of 158.16 g/mol. IUPAC name: 1,5-naphthyridine-2-carbaldehyde. InChIKey: VSBOITAWCYZQLT-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | 1,5-naphthyridine-2-carbaldehyde |
| InChIKey | VSBOITAWCYZQLT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)C=O)N=C1 |
Computed by PubChem (NCBI)