Products 884006-61-5
CAS 884006-61-5 is the registry number for cis-3-(Boc-amino)cyclopentanecarboxamide, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(1S,3R)-3-carbamoylcyclopentyl]carbamate (CAS 884006-61-5) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl N-[(1S,3R)-3-carbamoylcyclopentyl]carbamate. InChIKey: JAZMUABLLOLBIG-SFYZADRCSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl N-[(1S,3R)-3-carbamoylcyclopentyl]carbamate |
| InChIKey | JAZMUABLLOLBIG-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@H](C1)C(=O)N |
Computed by PubChem (NCBI)