CAS 884091-24-1 is the registry number for 2,2-Dimethyl-1-(4-methylphenyl)cyclopropanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2,2-dimethyl-1-(4-methylphenyl)cyclopropane-1-carboxylic acid (CAS 884091-24-1) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 2,2-dimethyl-1-(4-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: SSLIEVKLCVTOOJ-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 2,2-dimethyl-1-(4-methylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | SSLIEVKLCVTOOJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(CC2(C)C)C(=O)O |
Computed by PubChem (NCBI)