Products 884091-24-1

CAS 884091-24-1 is the registry number for 2,2-Dimethyl-1-(4-methylphenyl)cyclopropanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

2,2-dimethyl-1-(4-methylphenyl)cyclopropane-1-carboxylic acid (CAS 884091-24-1) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 2,2-dimethyl-1-(4-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: SSLIEVKLCVTOOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O2
Molecular weight204.26 g/mol
IUPAC name2,2-dimethyl-1-(4-methylphenyl)cyclopropane-1-carboxylic acid
InChIKeySSLIEVKLCVTOOJ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2(CC2(C)C)C(=O)O

Computed by PubChem (NCBI)