Products 884091-56-9
CAS 884091-56-9 appears in our catalog under these names: 1-(4-Methoxyphenyl)-2,2-dimethylcyclopropanecarboxylic acid, 95%, 1-(4-Methoxyphenyl)-2,2-dimethylcyclopropanecarboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
1-(4-methoxyphenyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 884091-56-9) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: GIRPVUVYVGNIEF-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | GIRPVUVYVGNIEF-UHFFFAOYSA-N |
| SMILES | CC1(CC1(C2=CC=C(C=C2)OC)C(=O)O)C |
Computed by PubChem (NCBI)