Products 884990-87-8

CAS 884990-87-8 is the registry number for 4-Chloro-3-[(2-methylphenyl)sulfamoyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-chloro-3-[(2-methylphenyl)sulfamoyl]benzoic acid (CAS 884990-87-8) is a chemical compound with the molecular formula C14H12ClNO4S and a molecular weight of 325.8 g/mol. IUPAC name: 4-chloro-3-[(2-methylphenyl)sulfamoyl]benzoic acid. InChIKey: CTPZLZGKFXJXTR-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12ClNO4S
Molecular weight325.8 g/mol
IUPAC name4-chloro-3-[(2-methylphenyl)sulfamoyl]benzoic acid
InChIKeyCTPZLZGKFXJXTR-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1NS(=O)(=O)C2=C(C=CC(=C2)C(=O)O)Cl

Computed by PubChem (NCBI)