CAS 117309-47-4 appears in our catalog under these names: (S)-2-(4-Chlorophenylsulfonamido)-2-phenylacetic acid, 98+%, 2-([(4-Chlorophenyl)sulfonyl]amino)-2-phenylacetic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 10g, 1g.
2-[(4-chlorophenyl)sulfonylamino]-2-phenylacetic acid (CAS 117309-47-4) is a chemical compound with the molecular formula C14H12ClNO4S and a molecular weight of 325.8 g/mol. IUPAC name: 2-[(4-chlorophenyl)sulfonylamino]-2-phenylacetic acid. InChIKey: RCGHLRLGTZRRKK-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO4S |
|---|---|
| Molecular weight | 325.8 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)sulfonylamino]-2-phenylacetic acid |
| InChIKey | RCGHLRLGTZRRKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)NS(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)