CAS 885269-36-3 appears in our catalog under these names: 2-([(4'-Chloro[1,1'-biphenyl]-4-yl)sulfonyl]amino)acetic acid, 95%, ((4'-Chloro-(1,1'-biphenyl)-4-yl)sulfonyl)glycine, 97%, ((4'–Chloro–(1,1'–biphenyl)–4–yl)sulfonyl)glycine, 2-([(4'-Chloro[1,1'-biphenyl]-4-yl)sulfonyl]amino)acetic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 10g, 250mg, 5g, 1g, 100mg.
2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]acetic acid (CAS 885269-36-3) is a chemical compound with the molecular formula C14H12ClNO4S and a molecular weight of 325.8 g/mol. IUPAC name: 2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]acetic acid. InChIKey: HGCYZTUZASOKFU-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO4S |
|---|---|
| Molecular weight | 325.8 g/mol |
| IUPAC name | 2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]acetic acid |
| InChIKey | HGCYZTUZASOKFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Cl)S(=O)(=O)NCC(=O)O |
Computed by PubChem (NCBI)