CAS 88521-64-6 appears in our catalog under these names: 2-(2-Formyl-4-methylphenoxy)acetic acid, 95%, 2-(2-Formyl-4-methylphenoxy)acetic acid, 2-(2-formyl-4-methylphenoxy)acetic acid, 95%, 95%, (2-Formyl-4-methylphenoxy)acetic acid, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 0,5g, 50mg, 100mg, 250mg.
2-(2-formyl-4-methylphenoxy)acetic acid (CAS 88521-64-6) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-(2-formyl-4-methylphenoxy)acetic acid. InChIKey: LBWSPPAVWSPIPM-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-(2-formyl-4-methylphenoxy)acetic acid |
| InChIKey | LBWSPPAVWSPIPM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC(=O)O)C=O |
Computed by PubChem (NCBI)