Products 885271-12-5
CAS 885271-12-5 appears in our catalog under these names: 2-(2-Bromophenyl)-4-(tert-butyl)-4,5-dihydrooxazole, 95%, 95%, 2-(2-Bromophenyl)-4-(tert-butyl)-4,5-dihydrooxazole, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(2-bromophenyl)-4-tert-butyl-4,5-dihydro-1,3-oxazole (CAS 885271-12-5) is a chemical compound with the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. IUPAC name: 2-(2-bromophenyl)-4-tert-butyl-4,5-dihydro-1,3-oxazole. InChIKey: NJQJYOLYDOCZGX-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO |
|---|---|
| Molecular weight | 282.18 g/mol |
| IUPAC name | 2-(2-bromophenyl)-4-tert-butyl-4,5-dihydro-1,3-oxazole |
| InChIKey | NJQJYOLYDOCZGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1COC(=N1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)