CAS 885519-58-4 appears in our catalog under these names: 4,6-Dichloro-1H-indazole 97%, 4,6-Dichloro-1H-indazole, 97%, 97%, 4,6-Dichloro-1H-indazole, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4,6-dichloro-1H-indazole (CAS 885519-58-4) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 4,6-dichloro-1H-indazole. InChIKey: KTTXUMXAFXKIMN-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 4,6-dichloro-1H-indazole |
| InChIKey | KTTXUMXAFXKIMN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NN=C2)Cl)Cl |
Computed by PubChem (NCBI)