CAS 885521-68-6 is the registry number for 3,4-Dibromo-1H-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3,4-dibromo-2H-indazole (CAS 885521-68-6) is a chemical compound with the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. IUPAC name: 3,4-dibromo-2H-indazole. InChIKey: IOWRYEIOYGPYCA-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2 |
|---|---|
| Molecular weight | 275.93 g/mol |
| IUPAC name | 3,4-dibromo-2H-indazole |
| InChIKey | IOWRYEIOYGPYCA-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C(=C1)Br)Br |
Computed by PubChem (NCBI)