Products 885529-64-6
CAS 885529-64-6 appears in our catalog under these names: 5-Ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-amine, 95%, 5-Ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-amine (CAS 885529-64-6) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-amine. InChIKey: RXMXPEKPQQPYMZ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-amine |
| InChIKey | RXMXPEKPQQPYMZ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)CC(O2)C)N |
Computed by PubChem (NCBI)