Products 885959-44-4

CAS 885959-44-4 is the registry number for 5-(4-Trifluoromethylphenyl)nicotinic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

5-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid (CAS 885959-44-4) is a chemical compound with the molecular formula C13H8F3NO2 and a molecular weight of 267.20 g/mol. IUPAC name: 5-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid. InChIKey: PLXNLWPGOSMAHX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8F3NO2
Molecular weight267.20 g/mol
IUPAC name5-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid
InChIKeyPLXNLWPGOSMAHX-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC(=CN=C2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)