CAS 885966-97-2 is the registry number for N-Hydroxyphenanthrene-9-carboximidamide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
N'-hydroxyphenanthrene-9-carboximidamide (CAS 885966-97-2) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: N'-hydroxyphenanthrene-9-carboximidamide. InChIKey: ZDHLPYXRSPWJRR-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | N'-hydroxyphenanthrene-9-carboximidamide |
| InChIKey | ZDHLPYXRSPWJRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)/C(=N/O)/N |
Computed by PubChem (NCBI)