CAS 886362-95-4 appears in our catalog under these names: 4-(1,8-Maphthyridin-2-yl)butanoic acid, 98%, 4-(1,8-Maphthyridin-2-yl)butanoic acid, 98%, 98%, 1,8-Naphthyridine-2-butanoic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4-(1,8-naphthyridin-2-yl)butanoic acid (CAS 886362-95-4) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 4-(1,8-naphthyridin-2-yl)butanoic acid. InChIKey: HFBITYXPNVQAGU-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 4-(1,8-naphthyridin-2-yl)butanoic acid |
| InChIKey | HFBITYXPNVQAGU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(C=C2)CCCC(=O)O |
Computed by PubChem (NCBI)