Products 886436-48-2
CAS 886436-48-2 is the registry number for 6-Bromo-3,3-dimethylimidazo[1,2-a]pyridin-2(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
6-bromo-3,3-dimethylimidazo[1,2-a]pyridin-2-one (CAS 886436-48-2) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 6-bromo-3,3-dimethylimidazo[1,2-a]pyridin-2-one. InChIKey: DRHQKHZBHWENPB-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 6-bromo-3,3-dimethylimidazo[1,2-a]pyridin-2-one |
| InChIKey | DRHQKHZBHWENPB-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N=C2N1C=C(C=C2)Br)C |
Computed by PubChem (NCBI)