CAS 886497-50-3 appears in our catalog under these names: 5-(4-Methylphenyl)-1,2,4-triazin-3-amine, 5-(p-Tolyl)-1,2,4-triazin-3-amine, 98+%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
5-(4-methylphenyl)-1,2,4-triazin-3-amine (CAS 886497-50-3) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 5-(4-methylphenyl)-1,2,4-triazin-3-amine. InChIKey: SRECBXKODHBXNE-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 5-(4-methylphenyl)-1,2,4-triazin-3-amine |
| InChIKey | SRECBXKODHBXNE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CN=NC(=N2)N |
Computed by PubChem (NCBI)