CAS 88660-53-1 appears in our catalog under these names: Nicotine Benzoate, Nicotine Benzoate, >95% (HPLC). Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: on request, 100mg, 1g, 500mg, 10mg, 25g, 50g, 100g.
Benzoic acid;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine (CAS 88660-53-1) is a chemical compound with the molecular formula C17H20N2O2 and a molecular weight of 284.35 g/mol. IUPAC name: benzoic acid;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine. InChIKey: VAUQRLHPXWYZRZ-PPHPATTJSA-N.
| Molecular formula | C17H20N2O2 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | benzoic acid;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| InChIKey | VAUQRLHPXWYZRZ-PPHPATTJSA-N |
| SMILES | CN1CCC[C@H]1C2=CN=CC=C2.C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)