CAS 886762-08-9 appears in our catalog under these names: 5–Bromo–2–(trifluoromethoxy)aniline, 5-Bromo-2-(trifluoromethoxy)aniline, 98%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100g, 25g, 500g.
5-bromo-2-(trifluoromethoxy)aniline (CAS 886762-08-9) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 5-bromo-2-(trifluoromethoxy)aniline. InChIKey: FOJWHUFRHXEUBA-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 5-bromo-2-(trifluoromethoxy)aniline |
| InChIKey | FOJWHUFRHXEUBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)N)OC(F)(F)F |
Computed by PubChem (NCBI)