CAS 886768-65-6 is the registry number for tert-Butyl 3-(2,5-difluorophenyl)piperazine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3-(2,5-difluorophenyl)piperazine-1-carboxylate (CAS 886768-65-6) is a chemical compound with the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. IUPAC name: tert-butyl 3-(2,5-difluorophenyl)piperazine-1-carboxylate. InChIKey: FFGIKYZKXQYOOG-UHFFFAOYSA-N.
| Molecular formula | C15H20F2N2O2 |
|---|---|
| Molecular weight | 298.33 g/mol |
| IUPAC name | tert-butyl 3-(2,5-difluorophenyl)piperazine-1-carboxylate |
| InChIKey | FFGIKYZKXQYOOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C1)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)