Products 886768-90-7

CAS 886768-90-7 is the registry number for tert-Butyl 3-(3,5-difluorophenyl)piperazine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-(3,5-difluorophenyl)piperazine-1-carboxylate (CAS 886768-90-7) is a chemical compound with the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. IUPAC name: tert-butyl 3-(3,5-difluorophenyl)piperazine-1-carboxylate. InChIKey: PMCOHINFZQLKMH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20F2N2O2
Molecular weight298.33 g/mol
IUPAC nametert-butyl 3-(3,5-difluorophenyl)piperazine-1-carboxylate
InChIKeyPMCOHINFZQLKMH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCNC(C1)C2=CC(=CC(=C2)F)F

Computed by PubChem (NCBI)