Products 951626-76-9

CAS 951626-76-9 is the registry number for tert-Butyl 4-(2,6-difluorophenyl)piperazine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(2,6-difluorophenyl)piperazine-1-carboxylate (CAS 951626-76-9) is a chemical compound with the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. IUPAC name: tert-butyl 4-(2,6-difluorophenyl)piperazine-1-carboxylate. InChIKey: BIXPVXXKHUCNEU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20F2N2O2
Molecular weight298.33 g/mol
IUPAC nametert-butyl 4-(2,6-difluorophenyl)piperazine-1-carboxylate
InChIKeyBIXPVXXKHUCNEU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(CC1)C2=C(C=CC=C2F)F

Computed by PubChem (NCBI)