CAS 1240582-40-4 is the registry number for tert-Butyl (R)-3-(3,5-difluorophenyl)piperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R)-3-(3,5-difluorophenyl)piperazine-1-carboxylate (CAS 1240582-40-4) is a chemical compound with the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. IUPAC name: tert-butyl (3R)-3-(3,5-difluorophenyl)piperazine-1-carboxylate. InChIKey: PMCOHINFZQLKMH-ZDUSSCGKSA-N.
| Molecular formula | C15H20F2N2O2 |
|---|---|
| Molecular weight | 298.33 g/mol |
| IUPAC name | tert-butyl (3R)-3-(3,5-difluorophenyl)piperazine-1-carboxylate |
| InChIKey | PMCOHINFZQLKMH-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C1)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)