CAS 887352-22-9 is the registry number for 1-Acetyl-2,2,5,5-tetramethyl-3-pyrroline-3-carboxamide, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg.
1-acetyl-2,2,5,5-tetramethylpyrrole-3-carboxamide (CAS 887352-22-9) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: 1-acetyl-2,2,5,5-tetramethylpyrrole-3-carboxamide. InChIKey: IHLKBXBCPPDBEE-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 1-acetyl-2,2,5,5-tetramethylpyrrole-3-carboxamide |
| InChIKey | IHLKBXBCPPDBEE-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C(C=C(C1(C)C)C(=O)N)(C)C |
Computed by PubChem (NCBI)