Products 887405-88-1

CAS 887405-88-1 is the registry number for 2-((3,4-Dimethoxyphenyl)amino)-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.

Structural formula: {0} (CAS {1})

2-(3,4-dimethoxyanilino)-1,3-thiazole-4-carboxylic acid (CAS 887405-88-1) is a chemical compound with the molecular formula C12H12N2O4S and a molecular weight of 280.30 g/mol. IUPAC name: 2-(3,4-dimethoxyanilino)-1,3-thiazole-4-carboxylic acid. InChIKey: RLLKFRHYLSJZPF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12N2O4S
Molecular weight280.30 g/mol
IUPAC name2-(3,4-dimethoxyanilino)-1,3-thiazole-4-carboxylic acid
InChIKeyRLLKFRHYLSJZPF-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)NC2=NC(=CS2)C(=O)O)OC

Computed by PubChem (NCBI)