Products 887502-03-6

CAS 887502-03-6 is the registry number for 2-Amino-3-biphenyl-3-yl-propionic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-amino-3-(3-phenylphenyl)propanoic acid (CAS 887502-03-6) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 2-amino-3-(3-phenylphenyl)propanoic acid. InChIKey: XXPHIHDDXCFWMS-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15NO2
Molecular weight241.28 g/mol
IUPAC name2-amino-3-(3-phenylphenyl)propanoic acid
InChIKeyXXPHIHDDXCFWMS-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=CC(=C2)CC(C(=O)O)N

Computed by PubChem (NCBI)