CAS 164172-96-7 appears in our catalog under these names: (S)-2-Amino-3-biphenyl-3-yl-propionic acid, 95%, (S)-3-((1,1'-Biphenyl)-3-yl)-2-aminopropanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
(2S)-2-amino-3-(3-phenylphenyl)propanoic acid (CAS 164172-96-7) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: (2S)-2-amino-3-(3-phenylphenyl)propanoic acid. InChIKey: XXPHIHDDXCFWMS-AWEZNQCLSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-phenylphenyl)propanoic acid |
| InChIKey | XXPHIHDDXCFWMS-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)