Products 88751-41-1
CAS 88751-41-1 appears in our catalog under these names: (4-(1-Methyl-1H-pyrazol-4-yl)phenyl)methanol, 98%, (4-(1-Methyl-1H-pyrazol-4-yl)phenyl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[4-(1-methylpyrazol-4-yl)phenyl]methanol (CAS 88751-41-1) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: [4-(1-methylpyrazol-4-yl)phenyl]methanol. InChIKey: OZHBCHUQJZYPID-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | [4-(1-methylpyrazol-4-yl)phenyl]methanol |
| InChIKey | OZHBCHUQJZYPID-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)