Products 887571-22-4
CAS 887571-22-4 is the registry number for (5-Bromo-1-methyl-1H-1,3-benzodiazol-2-yl)methanol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(5-bromo-1-methylbenzimidazol-2-yl)methanol (CAS 887571-22-4) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: (5-bromo-1-methylbenzimidazol-2-yl)methanol. InChIKey: VVVFEOSCKXCYBU-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | (5-bromo-1-methylbenzimidazol-2-yl)methanol |
| InChIKey | VVVFEOSCKXCYBU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)N=C1CO |
Computed by PubChem (NCBI)