Products 887581-46-6

CAS 887581-46-6 is the registry number for 4-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(trifluoromethoxy)-1H-indazole-3-carboxylic acid (CAS 887581-46-6) is a chemical compound with the molecular formula C9H5F3N2O3 and a molecular weight of 246.14 g/mol. IUPAC name: 4-(trifluoromethoxy)-1H-indazole-3-carboxylic acid. InChIKey: UZSZKLOWCYNRFT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5F3N2O3
Molecular weight246.14 g/mol
IUPAC name4-(trifluoromethoxy)-1H-indazole-3-carboxylic acid
InChIKeyUZSZKLOWCYNRFT-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)OC(F)(F)F)C(=NN2)C(=O)O

Computed by PubChem (NCBI)