CAS 869782-94-5 appears in our catalog under these names: 5–TRIFLUOROMETHOXY–1H–INDAZOLE–3–CARBOXYLIC ACID, 5-(Trifluoromethoxy)-1h-indazole-3-carboxylic acid, 95%, 5-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg, 5g.
5-(trifluoromethoxy)-1H-indazole-3-carboxylic acid (CAS 869782-94-5) is a chemical compound with the molecular formula C9H5F3N2O3 and a molecular weight of 246.14 g/mol. IUPAC name: 5-(trifluoromethoxy)-1H-indazole-3-carboxylic acid. InChIKey: DJKYXGHMEGLNLG-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O3 |
|---|---|
| Molecular weight | 246.14 g/mol |
| IUPAC name | 5-(trifluoromethoxy)-1H-indazole-3-carboxylic acid |
| InChIKey | DJKYXGHMEGLNLG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)