CAS 959236-83-0 is the registry number for 8-(Trifluoromethoxy)quinazoline-2,4(1h,3h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
8-(trifluoromethoxy)-1H-quinazoline-2,4-dione (CAS 959236-83-0) is a chemical compound with the molecular formula C9H5F3N2O3 and a molecular weight of 246.14 g/mol. IUPAC name: 8-(trifluoromethoxy)-1H-quinazoline-2,4-dione. InChIKey: FVQOONKLIQLJCV-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O3 |
|---|---|
| Molecular weight | 246.14 g/mol |
| IUPAC name | 8-(trifluoromethoxy)-1H-quinazoline-2,4-dione |
| InChIKey | FVQOONKLIQLJCV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)OC(F)(F)F)NC(=O)NC2=O |
Computed by PubChem (NCBI)