CAS 869782-97-8 appears in our catalog under these names: 6-Trifluoromethoxy-3-indazolecarboxylic acid, 97%, 6-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid, 97%, 6-TRIFLUOROMETHOXY-1H-INDAZOLE-3-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg, 10g, 500mg.
6-(trifluoromethoxy)-1H-indazole-3-carboxylic acid (CAS 869782-97-8) is a chemical compound with the molecular formula C9H5F3N2O3 and a molecular weight of 246.14 g/mol. IUPAC name: 6-(trifluoromethoxy)-1H-indazole-3-carboxylic acid. InChIKey: DBSBRTKNVSHDMD-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O3 |
|---|---|
| Molecular weight | 246.14 g/mol |
| IUPAC name | 6-(trifluoromethoxy)-1H-indazole-3-carboxylic acid |
| InChIKey | DBSBRTKNVSHDMD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)NN=C2C(=O)O |
Computed by PubChem (NCBI)