CAS 887927-59-5 appears in our catalog under these names: (+)–2,5–epi Goniothalesdiol, (+)-2,5-epi-Goniothalesdiol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, Get quote.
Methyl 3-[(2R,3S,4S,5S)-3,4-dihydroxy-5-phenyloxolan-2-yl]propanoate (CAS 887927-59-5) is a chemical compound with the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. IUPAC name: methyl 3-[(2R,3S,4S,5S)-3,4-dihydroxy-5-phenyloxolan-2-yl]propanoate. InChIKey: RUDVTXZKYPJLFH-ZZVYKPCYSA-N.
| Molecular formula | C14H18O5 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | methyl 3-[(2R,3S,4S,5S)-3,4-dihydroxy-5-phenyloxolan-2-yl]propanoate |
| InChIKey | RUDVTXZKYPJLFH-ZZVYKPCYSA-N |
| SMILES | COC(=O)CC[C@@H]1[C@H]([C@@H]([C@@H](O1)C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)