Products 887982-40-3
CAS 887982-40-3 appears in our catalog under these names: 6-(3-Fluorophenyl)picolinic acid, 98%, 6-(3-Fluorophenyl)-2-pyridinecarboxylic Acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
6-(3-fluorophenyl)pyridine-2-carboxylic acid (CAS 887982-40-3) is a chemical compound with the molecular formula C12H8FNO2 and a molecular weight of 217.20 g/mol. IUPAC name: 6-(3-fluorophenyl)pyridine-2-carboxylic acid. InChIKey: LNVROFCFAZOMJU-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO2 |
|---|---|
| Molecular weight | 217.20 g/mol |
| IUPAC name | 6-(3-fluorophenyl)pyridine-2-carboxylic acid |
| InChIKey | LNVROFCFAZOMJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)