Products 88807-89-0

CAS 88807-89-0 appears in our catalog under these names: 2-Amino-2-cyclopropylpropanoic acid hydrochloride, 96%, 2-Amino-2-cyclopropylpropanoic acid HCl. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g.

Structural formula: {0} (CAS {1})

2-amino-2-cyclopropylpropanoic acid;hydrochloride (CAS 88807-89-0) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: 2-amino-2-cyclopropylpropanoic acid;hydrochloride. InChIKey: CCTPHSLKVQNBGO-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO2
Molecular weight165.62 g/mol
IUPAC name2-amino-2-cyclopropylpropanoic acid;hydrochloride
InChIKeyCCTPHSLKVQNBGO-UHFFFAOYSA-N
SMILESCC(C1CC1)(C(=O)O)N.Cl

Computed by PubChem (NCBI)