Products 889112-17-8
CAS 889112-17-8 is the registry number for 8-(6,7-Dihydroxy-3,7-dimethyl-2E-octenyloxy)psoralen. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-[(E)-6,7-dihydroxy-3,7-dimethyloct-2-enoxy]furo[3,2-g]chromen-7-one (CAS 889112-17-8) is a chemical compound with the molecular formula C21H24O6 and a molecular weight of 372.4 g/mol. IUPAC name: 9-[(E)-6,7-dihydroxy-3,7-dimethyloct-2-enoxy]furo[3,2-g]chromen-7-one. InChIKey: HWQSPRJGHSGSPF-MDWZMJQESA-N.
| Molecular formula | C21H24O6 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 9-[(E)-6,7-dihydroxy-3,7-dimethyloct-2-enoxy]furo[3,2-g]chromen-7-one |
| InChIKey | HWQSPRJGHSGSPF-MDWZMJQESA-N |
| SMILES | C/C(=C\COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2)/CCC(C(C)(C)O)O |
Computed by PubChem (NCBI)