CAS 889460-62-2 appears in our catalog under these names: (S)-3-Amino-5-methyl-2,3-dihydrobenzo[b][1,4]oxazepin-4(5H)-one, 97%, 97%, (S)-3-Amino-5-methyl-2,3-dihydrobenzo[b][1,4]oxazepin-4(5H)-one, 97%, (S)-3-Amino-5-methyl-2,3-dihydrobenzo[b][1,4]oxazepin-4(5H)-one, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 50mg.
(3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one (CAS 889460-62-2) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one. InChIKey: WGQRJYAYYNVCJS-ZETCQYMHSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| InChIKey | WGQRJYAYYNVCJS-ZETCQYMHSA-N |
| SMILES | CN1C2=CC=CC=C2OC[C@@H](C1=O)N |
Computed by PubChem (NCBI)