Products 889673-49-8
CAS 889673-49-8 appears in our catalog under these names: Ethyl 2-amino-5-phenylbenzoate, Ethyl 2-amino-5-phenylbenzoate 95%, Ethyl 2-amino-5-phenylbenzoate, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
Ethyl 2-amino-5-phenylbenzoate (CAS 889673-49-8) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: ethyl 2-amino-5-phenylbenzoate. InChIKey: JOIQYEPWQHFNRA-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | ethyl 2-amino-5-phenylbenzoate |
| InChIKey | JOIQYEPWQHFNRA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)