Products 889939-76-8
CAS 889939-76-8 appears in our catalog under these names: 1-(1-(4-Fluorophenyl)propyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%, 1-(1-(4-Fluorophenyl)propyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%+. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[1-(4-fluorophenyl)propyl]triazole-4-carboxylic acid (CAS 889939-76-8) is a chemical compound with the molecular formula C12H12FN3O2 and a molecular weight of 249.24 g/mol. IUPAC name: 1-[1-(4-fluorophenyl)propyl]triazole-4-carboxylic acid. InChIKey: HYHHEXXYIPJDKD-UHFFFAOYSA-N.
| Molecular formula | C12H12FN3O2 |
|---|---|
| Molecular weight | 249.24 g/mol |
| IUPAC name | 1-[1-(4-fluorophenyl)propyl]triazole-4-carboxylic acid |
| InChIKey | HYHHEXXYIPJDKD-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=C(C=C1)F)N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)