Products 889939-98-4
CAS 889939-98-4 appears in our catalog under these names: 6-Methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 95%, 6-Methylpyrazolo(1,5-a)pyrimidine-2-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
6-methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid (CAS 889939-98-4) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 6-methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid. InChIKey: KTXQJOIYJTZWDA-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 6-methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
| InChIKey | KTXQJOIYJTZWDA-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=CC(=N2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)