CAS 890092-35-0 is the registry number for 5-Chloro-4,6-dimethylnicotinamide, 95%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
5-chloro-4,6-dimethylpyridine-3-carboxamide (CAS 890092-35-0) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 5-chloro-4,6-dimethylpyridine-3-carboxamide. InChIKey: AUNWPLQTWPWZDR-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 5-chloro-4,6-dimethylpyridine-3-carboxamide |
| InChIKey | AUNWPLQTWPWZDR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1C(=O)N)C)Cl |
Computed by PubChem (NCBI)