CAS 890624-27-8 is the registry number for 1'-Butyl-3',5'-dimethyl-1H,1'H-3,4'-bipyrazole-5-carboxylic Acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-(1-butyl-3,5-dimethylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid (CAS 890624-27-8) is a chemical compound with the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. IUPAC name: 3-(1-butyl-3,5-dimethylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid. InChIKey: BSUAMELCXIVJLE-UHFFFAOYSA-N.
| Molecular formula | C13H18N4O2 |
|---|---|
| Molecular weight | 262.31 g/mol |
| IUPAC name | 3-(1-butyl-3,5-dimethylpyrazol-4-yl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | BSUAMELCXIVJLE-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=C(C(=N1)C)C2=NNC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)